C10H14ClN5 — CID 102807363
4-(1-chloropropyl)-1-(1,3-dimethylpyrazol-4-yl)triazole (PubChem CID 102807363) has the molecular formula C10H14ClN5 and a molecular weight of 239.71 g/mol. Its IUPAC name is 4-(1-chloropropyl)-1-(1,3-dimethylpyrazol-4-yl)triazole.
| Compound Name | 4-(1-chloropropyl)-1-(1,3-dimethylpyrazol-4-yl)triazole |
|---|---|
| PubChem CID | 102807363 |
| Molecular Formula | C10H14ClN5 |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 4-(1-chloropropyl)-1-(1,3-dimethylpyrazol-4-yl)triazole |
| SMILES | CCC(Cl)c1cn(-c2cn(C)nc2C)nn1 |
| InChI | InChI=1S/C10H14ClN5/c1-4-8(11)9-5-16(14-12-9)10-6-15(3)13-7(10)2/h5-6,8H,4H2,1-3H3 |
| InChIKey | BPVSPVAZJDZRBE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|