C10H13ClF3N3O2S — CID 102809284
4-chloro-2-(2-methoxyethyl)-5-[2-(trifluoromethylsulfanyl)ethylamino]pyridazin-3-one (PubChem CID 102809284) has the molecular formula C10H13ClF3N3O2S and a molecular weight of 331.75 g/mol. Its IUPAC name is 4-chloro-2-(2-methoxyethyl)-5-[2-(trifluoromethylsulfanyl)ethylamino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(2-methoxyethyl)-5-[2-(trifluoromethylsulfanyl)ethylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 102809284 |
| Molecular Formula | C10H13ClF3N3O2S |
| Molecular Weight | 331.75 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-chloro-2-(2-methoxyethyl)-5-[2-(trifluoromethylsulfanyl)ethylamino]pyridazin-3-one |
| SMILES | COCCn1ncc(NCCSC(F)(F)F)c(Cl)c1=O |
| InChI | InChI=1S/C10H13ClF3N3O2S/c1-19-4-3-17-9(18)8(11)7(6-16-17)15-2-5-20-10(12,13)14/h6,15H,2-5H2,1H3 |
| InChIKey | SBIRHUFAZRKRGL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|