C9H12ClF2N3O2 — CID 103081449
4-chloro-5-[2-(2,2-difluoroethoxy)ethylamino]-2-methylpyridazin-3-one (PubChem CID 103081449) has the molecular formula C9H12ClF2N3O2 and a molecular weight of 267.66 g/mol. Its IUPAC name is 4-chloro-5-[2-(2,2-difluoroethoxy)ethylamino]-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-[2-(2,2-difluoroethoxy)ethylamino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 103081449 |
| Molecular Formula | C9H12ClF2N3O2 |
| Molecular Weight | 267.66 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-chloro-5-[2-(2,2-difluoroethoxy)ethylamino]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NCCOCC(F)F)c(Cl)c1=O |
| InChI | InChI=1S/C9H12ClF2N3O2/c1-15-9(16)8(10)6(4-14-15)13-2-3-17-5-7(11)12/h4,7,13H,2-3,5H2,1H3 |
| InChIKey | HXJUQSXZAUPWGO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.66 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|