C33H36N4O5 — CID 10281412
(4-nitrophenyl)methyl N-[3-(1H-indol-3-yl)-2-methyl-1-oxo-1-[(1-phenylcyclohexyl)methylamino]propan-2-yl]carbamate (PubChem CID 10281412) has the molecular formula C33H36N4O5 and a molecular weight of 568.67 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[3-(1H-indol-3-yl)-2-methyl-1-oxo-1-[(1-phenylcyclohexyl)methylamino]propan-2-yl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[3-(1H-indol-3-yl)-2-methyl-1-oxo-1-[(1-phenylcyclohexyl)methylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 10281412 |
| Molecular Formula | C33H36N4O5 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | (4-nitrophenyl)methyl N-[3-(1H-indol-3-yl)-2-methyl-1-oxo-1-[(1-phenylcyclohexyl)methylamino]propan-2-yl]carbamate |
| SMILES | CC(Cc1c[nH]c2ccccc12)(NC(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)NCC1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C33H36N4O5/c1-32(20-25-21-34-29-13-7-6-12-28(25)29,36-31(39)42-22-24-14-16-27(17-15-24)37(40)41)30(38)35-23-33(18-8-3-9-19-33)26-10-4-2-5-11-26/h2,4-7,10-17,21,34H,3,8-9,18-20,22-23H2,1H3,(H,35,38)(H,36,39) |
| InChIKey | GKWROAVHETXAFC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 126.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|