C26H31N5O5 — CID 59942271
(2S)-N-[(1-hydroxycyclohexyl)methyl]-3-(1H-indol-3-yl)-2-methyl-2-[(4-nitrophenyl)carbamoylamino]propanamide (PubChem CID 59942271) has the molecular formula C26H31N5O5 and a molecular weight of 493.56 g/mol. Its IUPAC name is (2S)-N-[(1-hydroxycyclohexyl)methyl]-3-(1H-indol-3-yl)-2-methyl-2-[(4-nitrophenyl)carbamoylamino]propanamide.
| Compound Name | (2S)-N-[(1-hydroxycyclohexyl)methyl]-3-(1H-indol-3-yl)-2-methyl-2-[(4-nitrophenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 59942271 |
| Molecular Formula | C26H31N5O5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | (2S)-N-[(1-hydroxycyclohexyl)methyl]-3-(1H-indol-3-yl)-2-methyl-2-[(4-nitrophenyl)carbamoylamino]propanamide |
| SMILES | C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C26H31N5O5/c1-25(15-18-16-27-22-8-4-3-7-21(18)22,23(32)28-17-26(34)13-5-2-6-14-26)30-24(33)29-19-9-11-20(12-10-19)31(35)36/h3-4,7-12,16,27,34H,2,5-6,13-15,17H2,1H3,(H,28,32)(H2,29,30,33)/t25-/m0/s1 |
| InChIKey | ZRFXLZPTZXNZSP-VWLOTQADSA-N |
| XLogP | 4.01 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|