C24H31N5O5 — CID 91318603
N-[[1-(5-methoxy-2-pyridinyl)cyclohexyl]methyl]-2-methyl-2-[(4-nitrophenyl)carbamoylamino]propanamide (PubChem CID 91318603) has the molecular formula C24H31N5O5 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[[1-(5-methoxy-2-pyridinyl)cyclohexyl]methyl]-2-methyl-2-[(4-nitrophenyl)carbamoylamino]propanamide.
| Compound Name | N-[[1-(5-methoxy-2-pyridinyl)cyclohexyl]methyl]-2-methyl-2-[(4-nitrophenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 91318603 |
| Molecular Formula | C24H31N5O5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | N-[[1-(5-methoxy-2-pyridinyl)cyclohexyl]methyl]-2-methyl-2-[(4-nitrophenyl)carbamoylamino]propanamide |
| SMILES | COc1ccc(C2(CNC(=O)C(C)(C)NC(=O)Nc3ccc([N+](=O)[O-])cc3)CCCCC2)nc1 |
| InChI | InChI=1S/C24H31N5O5/c1-23(2,28-22(31)27-17-7-9-18(10-8-17)29(32)33)21(30)26-16-24(13-5-4-6-14-24)20-12-11-19(34-3)15-25-20/h7-12,15H,4-6,13-14,16H2,1-3H3,(H,26,30)(H2,27,28,31) |
| InChIKey | LMBLHEYOCWDFDM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|