C31H33N5O4 — CID 10143582
N-[3-(1H-indol-3-yl)-2-methyl-1-oxo-1-[(1-pyridin-2-ylcyclohexyl)methylamino]propan-2-yl]-4-nitrobenzamide (PubChem CID 10143582) has the molecular formula C31H33N5O4 and a molecular weight of 539.64 g/mol. Its IUPAC name is N-[3-(1H-indol-3-yl)-2-methyl-1-oxo-1-[(1-pyridin-2-ylcyclohexyl)methylamino]propan-2-yl]-4-nitrobenzamide.
| Compound Name | N-[3-(1H-indol-3-yl)-2-methyl-1-oxo-1-[(1-pyridin-2-ylcyclohexyl)methylamino]propan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 10143582 |
| Molecular Formula | C31H33N5O4 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | N-[3-(1H-indol-3-yl)-2-methyl-1-oxo-1-[(1-pyridin-2-ylcyclohexyl)methylamino]propan-2-yl]-4-nitrobenzamide |
| SMILES | CC(Cc1c[nH]c2ccccc12)(NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)NCC1(c2ccccn2)CCCCC1 |
| InChI | InChI=1S/C31H33N5O4/c1-30(19-23-20-33-26-10-4-3-9-25(23)26,35-28(37)22-12-14-24(15-13-22)36(39)40)29(38)34-21-31(16-6-2-7-17-31)27-11-5-8-18-32-27/h3-5,8-15,18,20,33H,2,6-7,16-17,19,21H2,1H3,(H,34,38)(H,35,37) |
| InChIKey | MXUYTPAMPGUNDN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|