C16H13BrN2 — CID 102815043
3-bromo-5-(3,4-dihydro-1H-isoquinolin-2-yl)benzonitrile (PubChem CID 102815043) has the molecular formula C16H13BrN2 and a molecular weight of 313.20 g/mol. Its IUPAC name is 3-bromo-5-(3,4-dihydro-1H-isoquinolin-2-yl)benzonitrile.
| Compound Name | 3-bromo-5-(3,4-dihydro-1H-isoquinolin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 102815043 |
| Molecular Formula | C16H13BrN2 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 3-bromo-5-(3,4-dihydro-1H-isoquinolin-2-yl)benzonitrile |
| SMILES | N#Cc1cc(Br)cc(N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C16H13BrN2/c17-15-7-12(10-18)8-16(9-15)19-6-5-13-3-1-2-4-14(13)11-19/h1-4,7-9H,5-6,11H2 |
| InChIKey | JDQNBEFGMLHCIF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |