About 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile
3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile (PubChem CID 102816346) has the molecular formula C16H21FN2
and a molecular weight of 260.36 g/mol. Its IUPAC name is 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile.
Molecular Properties
| Compound Name | 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile |
| PubChem CID | 102816346 |
| Molecular Formula | C16H21FN2 |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile |
| SMILES | CCC1(CC)CCN(c2cc(F)cc(C#N)c2)CC1 |
| InChI | InChI=1S/C16H21FN2/c1-3-16(4-2)5-7-19(8-6-16)15-10-13(12-18)9-14(17)11-15/h9-11H,3-8H2,1-2H3 |
| InChIKey | ZAUXEMHEBLQNMJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile?
The IUPAC name of 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile (CID 102816346) is 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile.
What is the SMILES notation for 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile?
The canonical SMILES for 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile is CCC1(CC)CCN(c2cc(F)cc(C#N)c2)CC1.
What is the InChIKey of 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile?
The InChIKey is ZAUXEMHEBLQNMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21FN2/c1-3-16(4-2)5-7-19(8-6-16)15-10-13(12-18)9-14(17)11-15/h9-11H,3-8H2,1-2H3.
What are the key properties of 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile?
3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile has a molecular weight of 260.36 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile is sourced from PubChem (CID 102816346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).