C16H21FN2 — CID 102816346
3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile (PubChem CID 102816346) has the molecular formula C16H21FN2 and a molecular weight of 260.36 g/mol. Its IUPAC name is 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile.
| Compound Name | 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 102816346 |
| Molecular Formula | C16H21FN2 |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 3-(4,4-diethylpiperidin-1-yl)-5-fluorobenzonitrile |
| SMILES | CCC1(CC)CCN(c2cc(F)cc(C#N)c2)CC1 |
| InChI | InChI=1S/C16H21FN2/c1-3-16(4-2)5-7-19(8-6-16)15-10-13(12-18)9-14(17)11-15/h9-11H,3-8H2,1-2H3 |
| InChIKey | ZAUXEMHEBLQNMJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |