C13H15FN2 — CID 102816378
3-(2,2-dimethylpyrrolidin-1-yl)-5-fluorobenzonitrile (PubChem CID 102816378) has the molecular formula C13H15FN2 and a molecular weight of 218.28 g/mol. Its IUPAC name is 3-(2,2-dimethylpyrrolidin-1-yl)-5-fluorobenzonitrile.
| Compound Name | 3-(2,2-dimethylpyrrolidin-1-yl)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 102816378 |
| Molecular Formula | C13H15FN2 |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-(2,2-dimethylpyrrolidin-1-yl)-5-fluorobenzonitrile |
| SMILES | CC1(C)CCCN1c1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C13H15FN2/c1-13(2)4-3-5-16(13)12-7-10(9-15)6-11(14)8-12/h6-8H,3-5H2,1-2H3 |
| InChIKey | UJLRRECEFFTUTE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |