C13H12FN3O2 — CID 102816740
3-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-5-fluorobenzonitrile (PubChem CID 102816740) has the molecular formula C13H12FN3O2 and a molecular weight of 261.26 g/mol. Its IUPAC name is 3-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-5-fluorobenzonitrile.
| Compound Name | 3-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 102816740 |
| Molecular Formula | C13H12FN3O2 |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-5-fluorobenzonitrile |
| SMILES | CC1(C)C(=O)NC(=O)CN1c1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C13H12FN3O2/c1-13(2)12(19)16-11(18)7-17(13)10-4-8(6-15)3-9(14)5-10/h3-5H,7H2,1-2H3,(H,16,18,19) |
| InChIKey | ZDWKJZCRYHOBDH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|