C16H20FN3 — CID 102819076
3-(1,4-diazaspiro[5.5]undecan-1-yl)-5-fluorobenzonitrile (PubChem CID 102819076) has the molecular formula C16H20FN3 and a molecular weight of 273.35 g/mol. Its IUPAC name is 3-(1,4-diazaspiro[5.5]undecan-1-yl)-5-fluorobenzonitrile.
| Compound Name | 3-(1,4-diazaspiro[5.5]undecan-1-yl)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 102819076 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 3-(1,4-diazaspiro[5.5]undecan-1-yl)-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(N2CCNCC23CCCCC3)c1 |
| InChI | InChI=1S/C16H20FN3/c17-14-8-13(11-18)9-15(10-14)20-7-6-19-12-16(20)4-2-1-3-5-16/h8-10,19H,1-7,12H2 |
| InChIKey | WYPHUGQXSXYBMT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |