C40H75N2+ — CID 10281828
1-methyl-1,2-bis[(E)-octadec-9-enyl]imidazol-1-ium (PubChem CID 10281828) has the molecular formula C40H75N2+ and a molecular weight of 584.05 g/mol. Its IUPAC name is 1-methyl-1,2-bis[(E)-octadec-9-enyl]imidazol-1-ium.
| Compound Name | 1-methyl-1,2-bis[(E)-octadec-9-enyl]imidazol-1-ium |
|---|---|
| PubChem CID | 10281828 |
| Molecular Formula | C40H75N2+ |
| Molecular Weight | 584.05 g/mol |
| Exact Mass | 583.59 |
| IUPAC Name | 1-methyl-1,2-bis[(E)-octadec-9-enyl]imidazol-1-ium |
| SMILES | CCCCCCCC/C=C/CCCCCCCCC1=NC=C[N+]1(C)CCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C40H75N2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-40-41-37-39-42(40,3)38-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,37,39H,4-17,22-36,38H2,1-3H3/q+1/b20-18+,21-19+ |
| InChIKey | PTDZPNWBSQWZGB-FRCMOREXSA-N |
| XLogP | 13.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.05 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|