About 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one
2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one (PubChem CID 102819727) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one |
| PubChem CID | 102819727 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccccc2N(C[C@H]2CCCN2)C1=O |
| InChI | InChI=1S/C14H18N2O2/c1-10-14(17)16(9-11-5-4-8-15-11)12-6-2-3-7-13(12)18-10/h2-3,6-7,10-11,15H,4-5,8-9H2,1H3/t10?,11-/m1/s1 |
| InChIKey | IGTZWHRLTZWLEM-RRKGBCIJSA-N |
| XLogP | 1.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one?
The IUPAC name of 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one (CID 102819727) is 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one.
What is the SMILES notation for 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one?
The canonical SMILES for 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one is CC1Oc2ccccc2N(C[C@H]2CCCN2)C1=O.
What is the InChIKey of 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one?
The InChIKey is IGTZWHRLTZWLEM-RRKGBCIJSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-10-14(17)16(9-11-5-4-8-15-11)12-6-2-3-7-13(12)18-10/h2-3,6-7,10-11,15H,4-5,8-9H2,1H3/t10?,11-/m1/s1.
What are the key properties of 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one?
2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one has a molecular weight of 246.31 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[[(2R)-pyrrolidin-2-yl]methyl]-1,4-benzoxazin-3-one is sourced from PubChem (CID 102819727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).