C11H13N3OS — CID 102819743
3-[[(2S)-pyrrolidin-2-yl]methyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 102819743) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 3-[[(2S)-pyrrolidin-2-yl]methyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[[(2S)-pyrrolidin-2-yl]methyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 102819743 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-[[(2S)-pyrrolidin-2-yl]methyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2ncn1C[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H13N3OS/c15-11-10-9(3-5-16-10)13-7-14(11)6-8-2-1-4-12-8/h3,5,7-8,12H,1-2,4,6H2/t8-/m0/s1 |
| InChIKey | LHAKJSQYGRHDTO-QMMMGPOBSA-N |
| XLogP | 1.21 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |