C12H14N2OS — CID 112557042
5-(pyrrolidin-2-ylmethyl)thieno[3,2-c]pyridin-4-one (PubChem CID 112557042) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 5-(pyrrolidin-2-ylmethyl)thieno[3,2-c]pyridin-4-one.
| Compound Name | 5-(pyrrolidin-2-ylmethyl)thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 112557042 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 5-(pyrrolidin-2-ylmethyl)thieno[3,2-c]pyridin-4-one |
| SMILES | O=c1c2ccsc2ccn1CC1CCCN1 |
| InChI | InChI=1S/C12H14N2OS/c15-12-10-4-7-16-11(10)3-6-14(12)8-9-2-1-5-13-9/h3-4,6-7,9,13H,1-2,5,8H2 |
| InChIKey | XKMPBONRXPYGOK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |