C13H14N2O2 — CID 102821869
1-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]pyrrolidin-2-one (PubChem CID 102821869) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]pyrrolidin-2-one.
| Compound Name | 1-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 102821869 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1cc(C#CCCO)ccn1 |
| InChI | InChI=1S/C13H14N2O2/c16-9-2-1-4-11-6-7-14-12(10-11)15-8-3-5-13(15)17/h6-7,10,16H,2-3,5,8-9H2 |
| InChIKey | RSKPGDRPTJCPFO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|