C11H10N4O3 — CID 107409865
4-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]-1,2,4-triazolidine-3,5-dione (PubChem CID 107409865) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 4-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107409865 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH][nH]c(=O)n1-c1cc(C#CCCO)ccn1 |
| InChI | InChI=1S/C11H10N4O3/c16-6-2-1-3-8-4-5-12-9(7-8)15-10(17)13-14-11(15)18/h4-5,7,16H,2,6H2,(H,13,17)(H,14,18) |
| InChIKey | HSBJTROTCHHDOX-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|