C15H11FN2O3 — CID 102822099
(E)-3-[2-[(3-fluorobenzoyl)amino]-4-pyridinyl]prop-2-enoic acid (PubChem CID 102822099) has the molecular formula C15H11FN2O3 and a molecular weight of 286.26 g/mol. Its IUPAC name is (E)-3-[2-[(3-fluorobenzoyl)amino]-4-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[(3-fluorobenzoyl)amino]-4-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102822099 |
| Molecular Formula | C15H11FN2O3 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (E)-3-[2-[(3-fluorobenzoyl)amino]-4-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccnc(NC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C15H11FN2O3/c16-12-3-1-2-11(9-12)15(21)18-13-8-10(6-7-17-13)4-5-14(19)20/h1-9H,(H,19,20)(H,17,18,21)/b5-4+ |
| InChIKey | VCXJLOGJDIGBTF-SNAWJCMRSA-N |
| XLogP | 2.57 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|