C9H11ClN2O — CID 102824278
3-[(2-chloro-4-pyridinyl)amino]cyclobutan-1-ol (PubChem CID 102824278) has the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. Its IUPAC name is 3-[(2-chloro-4-pyridinyl)amino]cyclobutan-1-ol.
| Compound Name | 3-[(2-chloro-4-pyridinyl)amino]cyclobutan-1-ol |
|---|---|
| PubChem CID | 102824278 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 3-[(2-chloro-4-pyridinyl)amino]cyclobutan-1-ol |
| SMILES | OC1CC(Nc2ccnc(Cl)c2)C1 |
| InChI | InChI=1S/C9H11ClN2O/c10-9-5-6(1-2-11-9)12-7-3-8(13)4-7/h1-2,5,7-8,13H,3-4H2,(H,11,12) |
| InChIKey | BBMICAJNOPYPDH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|