C12H15ClN2 — CID 164655530
N-(2-bicyclo[4.1.0]heptanyl)-2-chloropyridin-4-amine (PubChem CID 164655530) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is N-(2-bicyclo[4.1.0]heptanyl)-2-chloropyridin-4-amine.
| Compound Name | N-(2-bicyclo[4.1.0]heptanyl)-2-chloropyridin-4-amine |
|---|---|
| PubChem CID | 164655530 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | N-(2-bicyclo[4.1.0]heptanyl)-2-chloropyridin-4-amine |
| SMILES | Clc1cc(NC2CCCC3CC32)ccn1 |
| InChI | InChI=1S/C12H15ClN2/c13-12-7-9(4-5-14-12)15-11-3-1-2-8-6-10(8)11/h4-5,7-8,10-11H,1-3,6H2,(H,14,15) |
| InChIKey | IBNKSVCWUCTVOM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|