C10H13ClN2O — CID 130671043
2-chloro-N-[(2R,3R)-2-methyloxolan-3-yl]pyridin-4-amine (PubChem CID 130671043) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-chloro-N-[(2R,3R)-2-methyloxolan-3-yl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[(2R,3R)-2-methyloxolan-3-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 130671043 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-chloro-N-[(2R,3R)-2-methyloxolan-3-yl]pyridin-4-amine |
| SMILES | C[C@H]1OCC[C@H]1Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H13ClN2O/c1-7-9(3-5-14-7)13-8-2-4-12-10(11)6-8/h2,4,6-7,9H,3,5H2,1H3,(H,12,13)/t7-,9-/m1/s1 |
| InChIKey | DOQIOVLUKJLRGU-VXNVDRBHSA-N |
| XLogP | 2.32 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|