C32H40N2O7S2 — CID 10282750
(2S)-2-[benzoyl-[[4-[2-(butoxycarbonylsulfamoyl)-5-(2-methylpropyl)thiophen-3-yl]phenyl]methyl]amino]-3-methylbutanoic acid (PubChem CID 10282750) has the molecular formula C32H40N2O7S2 and a molecular weight of 628.81 g/mol. Its IUPAC name is (2S)-2-[benzoyl-[[4-[2-(butoxycarbonylsulfamoyl)-5-(2-methylpropyl)thiophen-3-yl]phenyl]methyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[benzoyl-[[4-[2-(butoxycarbonylsulfamoyl)-5-(2-methylpropyl)thiophen-3-yl]phenyl]methyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 10282750 |
| Molecular Formula | C32H40N2O7S2 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | (2S)-2-[benzoyl-[[4-[2-(butoxycarbonylsulfamoyl)-5-(2-methylpropyl)thiophen-3-yl]phenyl]methyl]amino]-3-methylbutanoic acid |
| SMILES | CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(CN(C(=O)c2ccccc2)[C@H](C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C32H40N2O7S2/c1-6-7-17-41-32(38)33-43(39,40)31-27(19-26(42-31)18-21(2)3)24-15-13-23(14-16-24)20-34(28(22(4)5)30(36)37)29(35)25-11-9-8-10-12-25/h8-16,19,21-22,28H,6-7,17-18,20H2,1-5H3,(H,33,38)(H,36,37)/t28-/m0/s1 |
| InChIKey | MEHXBRKBDLIZQS-NDEPHWFRSA-N |
| XLogP | 6.58 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|