C25H34N2O5S2 — CID 46907082
butyl N-[5-(2-methylpropyl)-3-[4-[(4-oxopiperidin-1-yl)methyl]phenyl]thiophen-2-yl]sulfonylcarbamate (PubChem CID 46907082) has the molecular formula C25H34N2O5S2 and a molecular weight of 506.69 g/mol. Its IUPAC name is butyl N-[5-(2-methylpropyl)-3-[4-[(4-oxopiperidin-1-yl)methyl]phenyl]thiophen-2-yl]sulfonylcarbamate.
| Compound Name | butyl N-[5-(2-methylpropyl)-3-[4-[(4-oxopiperidin-1-yl)methyl]phenyl]thiophen-2-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 46907082 |
| Molecular Formula | C25H34N2O5S2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | butyl N-[5-(2-methylpropyl)-3-[4-[(4-oxopiperidin-1-yl)methyl]phenyl]thiophen-2-yl]sulfonylcarbamate |
| SMILES | CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(CN2CCC(=O)CC2)cc1 |
| InChI | InChI=1S/C25H34N2O5S2/c1-4-5-14-32-25(29)26-34(30,31)24-23(16-22(33-24)15-18(2)3)20-8-6-19(7-9-20)17-27-12-10-21(28)11-13-27/h6-9,16,18H,4-5,10-15,17H2,1-3H3,(H,26,29) |
| InChIKey | ITYQDBWXEGHHGW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|