C22H32N2O5S2 — CID 11213529
butyl N-[3-[4-[[methoxy(methyl)amino]methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate (PubChem CID 11213529) has the molecular formula C22H32N2O5S2 and a molecular weight of 468.64 g/mol. Its IUPAC name is butyl N-[3-[4-[[methoxy(methyl)amino]methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate.
| Compound Name | butyl N-[3-[4-[[methoxy(methyl)amino]methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 11213529 |
| Molecular Formula | C22H32N2O5S2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | butyl N-[3-[4-[[methoxy(methyl)amino]methyl]phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate |
| SMILES | CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(CN(C)OC)cc1 |
| InChI | InChI=1S/C22H32N2O5S2/c1-6-7-12-29-22(25)23-31(26,27)21-20(14-19(30-21)13-16(2)3)18-10-8-17(9-11-18)15-24(4)28-5/h8-11,14,16H,6-7,12-13,15H2,1-5H3,(H,23,25) |
| InChIKey | VLTRPKDYYMPPJZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|