C15H18BrNS2 — CID 102827690
N-[(4-bromo-5-methylthiophen-2-yl)-(2-methylsulfanylphenyl)methyl]ethanamine (PubChem CID 102827690) has the molecular formula C15H18BrNS2 and a molecular weight of 356.35 g/mol. Its IUPAC name is N-[(4-bromo-5-methylthiophen-2-yl)-(2-methylsulfanylphenyl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-5-methylthiophen-2-yl)-(2-methylsulfanylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 102827690 |
| Molecular Formula | C15H18BrNS2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | N-[(4-bromo-5-methylthiophen-2-yl)-(2-methylsulfanylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(Br)c(C)s1)c1ccccc1SC |
| InChI | InChI=1S/C15H18BrNS2/c1-4-17-15(14-9-12(16)10(2)19-14)11-7-5-6-8-13(11)18-3/h5-9,15,17H,4H2,1-3H3 |
| InChIKey | LOOCXQOLZZLDKT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |