C14H21BrOS — CID 102829789
(4-bromo-5-methylthiophen-2-yl)-(4-ethylcyclohexyl)methanol (PubChem CID 102829789) has the molecular formula C14H21BrOS and a molecular weight of 317.29 g/mol. Its IUPAC name is (4-bromo-5-methylthiophen-2-yl)-(4-ethylcyclohexyl)methanol.
| Compound Name | (4-bromo-5-methylthiophen-2-yl)-(4-ethylcyclohexyl)methanol |
|---|---|
| PubChem CID | 102829789 |
| Molecular Formula | C14H21BrOS |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (4-bromo-5-methylthiophen-2-yl)-(4-ethylcyclohexyl)methanol |
| SMILES | CCC1CCC(C(O)c2cc(Br)c(C)s2)CC1 |
| InChI | InChI=1S/C14H21BrOS/c1-3-10-4-6-11(7-5-10)14(16)13-8-12(15)9(2)17-13/h8,10-11,14,16H,3-7H2,1-2H3 |
| InChIKey | GXEUHCJGCJFOII-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |