C15H26N2S — CID 105313022
[(4,5-dimethylthiophen-2-yl)-(4-ethylcyclohexyl)methyl]hydrazine (PubChem CID 105313022) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is [(4,5-dimethylthiophen-2-yl)-(4-ethylcyclohexyl)methyl]hydrazine.
| Compound Name | [(4,5-dimethylthiophen-2-yl)-(4-ethylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105313022 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | [(4,5-dimethylthiophen-2-yl)-(4-ethylcyclohexyl)methyl]hydrazine |
| SMILES | CCC1CCC(C(NN)c2cc(C)c(C)s2)CC1 |
| InChI | InChI=1S/C15H26N2S/c1-4-12-5-7-13(8-6-12)15(17-16)14-9-10(2)11(3)18-14/h9,12-13,15,17H,4-8,16H2,1-3H3 |
| InChIKey | DNFFUSAAKRAEIN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|