C18H30N2S — CID 105312997
[(4-ethylcyclohexyl)-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)methyl]hydrazine (PubChem CID 105312997) has the molecular formula C18H30N2S and a molecular weight of 306.52 g/mol. Its IUPAC name is [(4-ethylcyclohexyl)-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)methyl]hydrazine.
| Compound Name | [(4-ethylcyclohexyl)-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105312997 |
| Molecular Formula | C18H30N2S |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | [(4-ethylcyclohexyl)-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)methyl]hydrazine |
| SMILES | CCC1CCC(C(NN)c2cc3c(s2)CCCCC3)CC1 |
| InChI | InChI=1S/C18H30N2S/c1-2-13-8-10-14(11-9-13)18(20-19)17-12-15-6-4-3-5-7-16(15)21-17/h12-14,18,20H,2-11,19H2,1H3 |
| InChIKey | XLNUQRGMGDSWEU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|