C15H24N2O2S2 — CID 105324223
[5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl-(3-methylsulfonylcyclohexyl)methyl]hydrazine (PubChem CID 105324223) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is [5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl-(3-methylsulfonylcyclohexyl)methyl]hydrazine.
| Compound Name | [5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl-(3-methylsulfonylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105324223 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl-(3-methylsulfonylcyclohexyl)methyl]hydrazine |
| SMILES | CS(=O)(=O)C1CCCC(C(NN)c2cc3c(s2)CCC3)C1 |
| InChI | InChI=1S/C15H24N2O2S2/c1-21(18,19)12-6-2-5-11(8-12)15(17-16)14-9-10-4-3-7-13(10)20-14/h9,11-12,15,17H,2-8,16H2,1H3 |
| InChIKey | PEBWBWGTQSCQMO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|