C15H13BrN2O2S — CID 102830215
5-[(4-bromo-5-methylthiophen-2-yl)methylamino]-2-methylisoindole-1,3-dione (PubChem CID 102830215) has the molecular formula C15H13BrN2O2S and a molecular weight of 365.25 g/mol. Its IUPAC name is 5-[(4-bromo-5-methylthiophen-2-yl)methylamino]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[(4-bromo-5-methylthiophen-2-yl)methylamino]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 102830215 |
| Molecular Formula | C15H13BrN2O2S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 5-[(4-bromo-5-methylthiophen-2-yl)methylamino]-2-methylisoindole-1,3-dione |
| SMILES | Cc1sc(CNc2ccc3c(c2)C(=O)N(C)C3=O)cc1Br |
| InChI | InChI=1S/C15H13BrN2O2S/c1-8-13(16)6-10(21-8)7-17-9-3-4-11-12(5-9)15(20)18(2)14(11)19/h3-6,17H,7H2,1-2H3 |
| InChIKey | YMSFOSKZUSDTME-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|