C15H19NO3S — CID 102840906
(2-methylthiophen-3-yl)-(2,3,4-trimethoxyphenyl)methanamine (PubChem CID 102840906) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is (2-methylthiophen-3-yl)-(2,3,4-trimethoxyphenyl)methanamine.
| Compound Name | (2-methylthiophen-3-yl)-(2,3,4-trimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 102840906 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (2-methylthiophen-3-yl)-(2,3,4-trimethoxyphenyl)methanamine |
| SMILES | COc1ccc(C(N)c2ccsc2C)c(OC)c1OC |
| InChI | InChI=1S/C15H19NO3S/c1-9-10(7-8-20-9)13(16)11-5-6-12(17-2)15(19-4)14(11)18-3/h5-8,13H,16H2,1-4H3 |
| InChIKey | JSAJEAMDFDIMAX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |