C10H16N2O2S — CID 102843367
[1,4-dioxan-2-yl-(2-methylthiophen-3-yl)methyl]hydrazine (PubChem CID 102843367) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is [1,4-dioxan-2-yl-(2-methylthiophen-3-yl)methyl]hydrazine.
| Compound Name | [1,4-dioxan-2-yl-(2-methylthiophen-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102843367 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | [1,4-dioxan-2-yl-(2-methylthiophen-3-yl)methyl]hydrazine |
| SMILES | Cc1sccc1C(NN)C1COCCO1 |
| InChI | InChI=1S/C10H16N2O2S/c1-7-8(2-5-15-7)10(12-11)9-6-13-3-4-14-9/h2,5,9-10,12H,3-4,6,11H2,1H3 |
| InChIKey | FKGPUWXYJWENDK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|