C9H14N2O3 — CID 105305979
[1,4-dioxan-2-yl(furan-2-yl)methyl]hydrazine (PubChem CID 105305979) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is [1,4-dioxan-2-yl(furan-2-yl)methyl]hydrazine.
| Compound Name | [1,4-dioxan-2-yl(furan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105305979 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | [1,4-dioxan-2-yl(furan-2-yl)methyl]hydrazine |
| SMILES | NNC(c1ccco1)C1COCCO1 |
| InChI | InChI=1S/C9H14N2O3/c10-11-9(7-2-1-3-13-7)8-6-12-4-5-14-8/h1-3,8-9,11H,4-6,10H2 |
| InChIKey | ACWAMOUKEZNYTE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|