C9H14N2O3S — CID 105258764
[(1,1-dioxothiolan-3-yl)-(furan-2-yl)methyl]hydrazine (PubChem CID 105258764) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is [(1,1-dioxothiolan-3-yl)-(furan-2-yl)methyl]hydrazine.
| Compound Name | [(1,1-dioxothiolan-3-yl)-(furan-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105258764 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | [(1,1-dioxothiolan-3-yl)-(furan-2-yl)methyl]hydrazine |
| SMILES | NNC(c1ccco1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H14N2O3S/c10-11-9(8-2-1-4-14-8)7-3-5-15(12,13)6-7/h1-2,4,7,9,11H,3,5-6,10H2 |
| InChIKey | QEARHPUWDXGQBK-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|