C10H13BrClNS — CID 102844812
3-(4-bromo-5-chlorothiophen-2-yl)-2,5-dimethylpyrrolidine (PubChem CID 102844812) has the molecular formula C10H13BrClNS and a molecular weight of 294.65 g/mol. Its IUPAC name is 3-(4-bromo-5-chlorothiophen-2-yl)-2,5-dimethylpyrrolidine.
| Compound Name | 3-(4-bromo-5-chlorothiophen-2-yl)-2,5-dimethylpyrrolidine |
|---|---|
| PubChem CID | 102844812 |
| Molecular Formula | C10H13BrClNS |
| Molecular Weight | 294.65 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | 3-(4-bromo-5-chlorothiophen-2-yl)-2,5-dimethylpyrrolidine |
| SMILES | CC1CC(c2cc(Br)c(Cl)s2)C(C)N1 |
| InChI | InChI=1S/C10H13BrClNS/c1-5-3-7(6(2)13-5)9-4-8(11)10(12)14-9/h4-7,13H,3H2,1-2H3 |
| InChIKey | ZTTQWSSKZLNYFD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |