C10H11BrClN3OS — CID 136964622
5-(4-bromo-5-chlorothiophen-2-yl)-2-propyliminoimidazolidin-4-one (PubChem CID 136964622) has the molecular formula C10H11BrClN3OS and a molecular weight of 336.64 g/mol. Its IUPAC name is 5-(4-bromo-5-chlorothiophen-2-yl)-2-propyliminoimidazolidin-4-one.
| Compound Name | 5-(4-bromo-5-chlorothiophen-2-yl)-2-propyliminoimidazolidin-4-one |
|---|---|
| PubChem CID | 136964622 |
| Molecular Formula | C10H11BrClN3OS |
| Molecular Weight | 336.64 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | 5-(4-bromo-5-chlorothiophen-2-yl)-2-propyliminoimidazolidin-4-one |
| SMILES | CCC/N=C1\NC(=O)C(c2cc(Br)c(Cl)s2)N1 |
| InChI | InChI=1S/C10H11BrClN3OS/c1-2-3-13-10-14-7(9(16)15-10)6-4-5(11)8(12)17-6/h4,7H,2-3H2,1H3,(H2,13,14,15,16) |
| InChIKey | ZJYIAQBVOXMGTA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.64 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|