C10H11BrClN3O2S — CID 136964624
5-(4-bromo-5-chlorothiophen-2-yl)-2-(2-methoxyethylimino)imidazolidin-4-one (PubChem CID 136964624) has the molecular formula C10H11BrClN3O2S and a molecular weight of 352.64 g/mol. Its IUPAC name is 5-(4-bromo-5-chlorothiophen-2-yl)-2-(2-methoxyethylimino)imidazolidin-4-one.
| Compound Name | 5-(4-bromo-5-chlorothiophen-2-yl)-2-(2-methoxyethylimino)imidazolidin-4-one |
|---|---|
| PubChem CID | 136964624 |
| Molecular Formula | C10H11BrClN3O2S |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 350.94 |
| IUPAC Name | 5-(4-bromo-5-chlorothiophen-2-yl)-2-(2-methoxyethylimino)imidazolidin-4-one |
| SMILES | COCC/N=C1\NC(=O)C(c2cc(Br)c(Cl)s2)N1 |
| InChI | InChI=1S/C10H11BrClN3O2S/c1-17-3-2-13-10-14-7(9(16)15-10)6-4-5(11)8(12)18-6/h4,7H,2-3H2,1H3,(H2,13,14,15,16) |
| InChIKey | ZNKVMBUOBAUOOC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|