C13H16BrNO2S — CID 102845439
4-(4-bromo-5-methylthiophen-2-yl)-3-propan-2-ylpiperidine-2,6-dione (PubChem CID 102845439) has the molecular formula C13H16BrNO2S and a molecular weight of 330.25 g/mol. Its IUPAC name is 4-(4-bromo-5-methylthiophen-2-yl)-3-propan-2-ylpiperidine-2,6-dione.
| Compound Name | 4-(4-bromo-5-methylthiophen-2-yl)-3-propan-2-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 102845439 |
| Molecular Formula | C13H16BrNO2S |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 4-(4-bromo-5-methylthiophen-2-yl)-3-propan-2-ylpiperidine-2,6-dione |
| SMILES | Cc1sc(C2CC(=O)NC(=O)C2C(C)C)cc1Br |
| InChI | InChI=1S/C13H16BrNO2S/c1-6(2)12-8(4-11(16)15-13(12)17)10-5-9(14)7(3)18-10/h5-6,8,12H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | YAMBYODGNJGMSG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|