C15H18BrNO2S — CID 102845446
4-(4-bromo-5-methylthiophen-2-yl)-3-cyclopentylpiperidine-2,6-dione (PubChem CID 102845446) has the molecular formula C15H18BrNO2S and a molecular weight of 356.29 g/mol. Its IUPAC name is 4-(4-bromo-5-methylthiophen-2-yl)-3-cyclopentylpiperidine-2,6-dione.
| Compound Name | 4-(4-bromo-5-methylthiophen-2-yl)-3-cyclopentylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 102845446 |
| Molecular Formula | C15H18BrNO2S |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 4-(4-bromo-5-methylthiophen-2-yl)-3-cyclopentylpiperidine-2,6-dione |
| SMILES | Cc1sc(C2CC(=O)NC(=O)C2C2CCCC2)cc1Br |
| InChI | InChI=1S/C15H18BrNO2S/c1-8-11(16)7-12(20-8)10-6-13(18)17-15(19)14(10)9-4-2-3-5-9/h7,9-10,14H,2-6H2,1H3,(H,17,18,19) |
| InChIKey | IEHYVQDCMJXCAI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|