C16H17BrClNO2 — CID 115926972
4-(3-bromo-4-chlorophenyl)-3-cyclopentylpiperidine-2,6-dione (PubChem CID 115926972) has the molecular formula C16H17BrClNO2 and a molecular weight of 370.67 g/mol. Its IUPAC name is 4-(3-bromo-4-chlorophenyl)-3-cyclopentylpiperidine-2,6-dione.
| Compound Name | 4-(3-bromo-4-chlorophenyl)-3-cyclopentylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 115926972 |
| Molecular Formula | C16H17BrClNO2 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 4-(3-bromo-4-chlorophenyl)-3-cyclopentylpiperidine-2,6-dione |
| SMILES | O=C1CC(c2ccc(Cl)c(Br)c2)C(C2CCCC2)C(=O)N1 |
| InChI | InChI=1S/C16H17BrClNO2/c17-12-7-10(5-6-13(12)18)11-8-14(20)19-16(21)15(11)9-3-1-2-4-9/h5-7,9,11,15H,1-4,8H2,(H,19,20,21) |
| InChIKey | GLWHWUVTLWINEP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|