C9H8Br2N4S — CID 102845932
1-(azetidin-3-yl)-4-(4,5-dibromothiophen-2-yl)triazole (PubChem CID 102845932) has the molecular formula C9H8Br2N4S and a molecular weight of 364.07 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4-(4,5-dibromothiophen-2-yl)triazole.
| Compound Name | 1-(azetidin-3-yl)-4-(4,5-dibromothiophen-2-yl)triazole |
|---|---|
| PubChem CID | 102845932 |
| Molecular Formula | C9H8Br2N4S |
| Molecular Weight | 364.07 g/mol |
| Exact Mass | 361.88 |
| IUPAC Name | 1-(azetidin-3-yl)-4-(4,5-dibromothiophen-2-yl)triazole |
| SMILES | Brc1cc(-c2cn(C3CNC3)nn2)sc1Br |
| InChI | InChI=1S/C9H8Br2N4S/c10-6-1-8(16-9(6)11)7-4-15(14-13-7)5-2-12-3-5/h1,4-5,12H,2-3H2 |
| InChIKey | BMPLXWBPYPACGS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.07 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |