C9H7Br2N3S2 — CID 115390281
4-cyclopropyl-3-(4,5-dibromothiophen-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 115390281) has the molecular formula C9H7Br2N3S2 and a molecular weight of 381.12 g/mol. Its IUPAC name is 4-cyclopropyl-3-(4,5-dibromothiophen-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclopropyl-3-(4,5-dibromothiophen-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115390281 |
| Molecular Formula | C9H7Br2N3S2 |
| Molecular Weight | 381.12 g/mol |
| Exact Mass | 378.84 |
| IUPAC Name | 4-cyclopropyl-3-(4,5-dibromothiophen-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2cc(Br)c(Br)s2)n1C1CC1 |
| InChI | InChI=1S/C9H7Br2N3S2/c10-5-3-6(16-7(5)11)8-12-13-9(15)14(8)4-1-2-4/h3-4H,1-2H2,(H,13,15) |
| InChIKey | NQIAKSSTFAYEHG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.12 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|