C14H10Br2O3S — CID 102846041
2-(4,5-dibromothiophen-2-yl)-7-methoxy-2,3-dihydrochromen-4-one (PubChem CID 102846041) has the molecular formula C14H10Br2O3S and a molecular weight of 418.11 g/mol. Its IUPAC name is 2-(4,5-dibromothiophen-2-yl)-7-methoxy-2,3-dihydrochromen-4-one.
| Compound Name | 2-(4,5-dibromothiophen-2-yl)-7-methoxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 102846041 |
| Molecular Formula | C14H10Br2O3S |
| Molecular Weight | 418.11 g/mol |
| Exact Mass | 415.87 |
| IUPAC Name | 2-(4,5-dibromothiophen-2-yl)-7-methoxy-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc2c(c1)OC(c1cc(Br)c(Br)s1)CC2=O |
| InChI | InChI=1S/C14H10Br2O3S/c1-18-7-2-3-8-10(17)6-12(19-11(8)4-7)13-5-9(15)14(16)20-13/h2-5,12H,6H2,1H3 |
| InChIKey | CNVRPMSJPPTVNU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.11 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |