C11H19N3O2 — CID 102847763
1-methyl-4-(pyrrolidine-1-carbonyl)-1,4-diazepan-2-one (PubChem CID 102847763) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-methyl-4-(pyrrolidine-1-carbonyl)-1,4-diazepan-2-one.
| Compound Name | 1-methyl-4-(pyrrolidine-1-carbonyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102847763 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-methyl-4-(pyrrolidine-1-carbonyl)-1,4-diazepan-2-one |
| SMILES | CN1CCCN(C(=O)N2CCCC2)CC1=O |
| InChI | InChI=1S/C11H19N3O2/c1-12-5-4-8-14(9-10(12)15)11(16)13-6-2-3-7-13/h2-9H2,1H3 |
| InChIKey | UOLVQUCCYOAFAQ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |