C9H16N2O2S — CID 107036798
1-methyl-4-(3-sulfanylpropanoyl)-1,4-diazepan-2-one (PubChem CID 107036798) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 1-methyl-4-(3-sulfanylpropanoyl)-1,4-diazepan-2-one.
| Compound Name | 1-methyl-4-(3-sulfanylpropanoyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 107036798 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-methyl-4-(3-sulfanylpropanoyl)-1,4-diazepan-2-one |
| SMILES | CN1CCCN(C(=O)CCS)CC1=O |
| InChI | InChI=1S/C9H16N2O2S/c1-10-4-2-5-11(7-9(10)13)8(12)3-6-14/h14H,2-7H2,1H3 |
| InChIKey | MMHABCNSNDXTSV-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|