C9H16N2O3 — CID 102892971
ethyl 4-methyl-3-oxo-1,4-diazepane-1-carboxylate (PubChem CID 102892971) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is ethyl 4-methyl-3-oxo-1,4-diazepane-1-carboxylate.
| Compound Name | ethyl 4-methyl-3-oxo-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 102892971 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | ethyl 4-methyl-3-oxo-1,4-diazepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCN(C)C(=O)C1 |
| InChI | InChI=1S/C9H16N2O3/c1-3-14-9(13)11-6-4-5-10(2)8(12)7-11/h3-7H2,1-2H3 |
| InChIKey | ONSUEHYPZRNVLS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |