C15H26N2O — CID 102849643
(Z)-1-(2,8-diazaspiro[5.5]undecan-2-yl)-2-methylpent-2-en-1-one (PubChem CID 102849643) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is (Z)-1-(2,8-diazaspiro[5.5]undecan-2-yl)-2-methylpent-2-en-1-one.
| Compound Name | (Z)-1-(2,8-diazaspiro[5.5]undecan-2-yl)-2-methylpent-2-en-1-one |
|---|---|
| PubChem CID | 102849643 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | (Z)-1-(2,8-diazaspiro[5.5]undecan-2-yl)-2-methylpent-2-en-1-one |
| SMILES | CC/C=C(/C)C(=O)N1CCCC2(CCCNC2)C1 |
| InChI | InChI=1S/C15H26N2O/c1-3-6-13(2)14(18)17-10-5-8-15(12-17)7-4-9-16-11-15/h6,16H,3-5,7-12H2,1-2H3/b13-6- |
| InChIKey | XXEWMQLDXMXCHY-MLPAPPSSSA-N |
| XLogP | 2.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|