C14H10BrF2N3O — CID 102854268
1-(5-bromo-2,4-difluorophenyl)-4-methoxybenzimidazol-2-amine (PubChem CID 102854268) has the molecular formula C14H10BrF2N3O and a molecular weight of 354.15 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)-4-methoxybenzimidazol-2-amine.
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)-4-methoxybenzimidazol-2-amine |
|---|---|
| PubChem CID | 102854268 |
| Molecular Formula | C14H10BrF2N3O |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)-4-methoxybenzimidazol-2-amine |
| SMILES | COc1cccc2c1nc(N)n2-c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C14H10BrF2N3O/c1-21-12-4-2-3-10-13(12)19-14(18)20(10)11-5-7(15)8(16)6-9(11)17/h2-6H,1H3,(H2,18,19) |
| InChIKey | QZENITDBKURXIN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|