C9H6BrF2N3O — CID 102855052
[1-(5-bromo-2,4-difluorophenyl)triazol-4-yl]methanol (PubChem CID 102855052) has the molecular formula C9H6BrF2N3O and a molecular weight of 290.07 g/mol. Its IUPAC name is [1-(5-bromo-2,4-difluorophenyl)triazol-4-yl]methanol.
| Compound Name | [1-(5-bromo-2,4-difluorophenyl)triazol-4-yl]methanol |
|---|---|
| PubChem CID | 102855052 |
| Molecular Formula | C9H6BrF2N3O |
| Molecular Weight | 290.07 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | [1-(5-bromo-2,4-difluorophenyl)triazol-4-yl]methanol |
| SMILES | OCc1cn(-c2cc(Br)c(F)cc2F)nn1 |
| InChI | InChI=1S/C9H6BrF2N3O/c10-6-1-9(8(12)2-7(6)11)15-3-5(4-16)13-14-15/h1-3,16H,4H2 |
| InChIKey | LVPWPUIHBAYWAH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.07 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|